| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-Ethyl-1-[(1,3-Benzodioxole-5-Yl)Methyl]Ethanamine |
|---|---|
| Synonyms | 1-(1,3-Benzodioxol-5-Yl)-N-Ethyl-Propan-2-Amine; [2-(1,3-Benzodioxol-5-Yl)-1-Methyl-Ethyl]-Ethyl-Amine; Mde (+-) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 14089-52-2 |
| SMILES | C1=C(CC(NCC)C)C=CC2=C1OCO2 |
| InChI | 1S/C12H17NO2/c1-3-13-9(2)6-10-4-5-11-12(7-10)15-8-14-11/h4-5,7,9,13H,3,6,8H2,1-2H3 |
| InChIKey | PVXVWWANJIWJOO-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.8±9.0°C at 760 mmHg (Cal.) |
| Flash point | 122.1±8.2°C (Cal.) |
| (1) | Francesco Barzagli, Fabrizio Mani and Maurizio Peruzzini. Continuous cycles of CO absorption and amine regeneration with aqueous alkanolamines: a comparison of the efficiency between pure and blended DEA, MDEA and AMP solutions by C NMR spectroscopy, Energy Environ. Sci., 2010, 3, 772. |
|---|---|
| Market Analysis Reports |