| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Bis(2-methyl-2-propanyl) (3-bromopropyl)imidodicarbonate |
|---|---|
| Synonyms | Bis(1,1-dimethylethyl)(3-bromopropyl) imidodicarbonate; Bis(1,1-dimethylethyl)(3-bromopropyl)imidodicarbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24BrNO4 |
| Molecular Weight | 338.24 |
| CAS Registry Number | 172846-33-2 |
| SMILES | CC(C)(C)OC(=O)N(CCCBr)C(=O)OC(C)(C)C |
| InChI | 1S/C13H24BrNO4/c1-12(2,3)18-10(16)15(9-7-8-14)11(17)19-13(4,5)6/h7-9H2,1-6H3 |
| InChIKey | SPEFPQDDFBRHTN-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.4±44.0°C at 760 mmHg (Cal.) |
| Flash point | 163.9±28.4°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| (1) | Sudipta Roy, Alan Eastman and Gordon W. Gribble. Synthesis of bisindolylmaleimides related to GF109203x and their efficient conversion to the bioactive indolocarbazoles, Org. Biomol. Chem., 2006, 4, 3228. |
|---|---|
| Market Analysis Reports |