| Suzhou Youzhihe Medical Science And Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.yzhmedical.com | |||
![]() | +86 (512) 3662-2426 | |||
![]() | sales@yzhmedical.com | |||
| Chemical distributor since 2018 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Name | 1,3-Propanedisulfonyl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C3H6Cl2O4S2 |
| Molecular Weight | 241.11 |
| CAS Registry Number | 20686-91-3 |
| SMILES | C(CS(=O)(=O)Cl)CS(=O)(=O)Cl |
| Solubility | 3.621 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.517, Calc.* |
| Melting point | 114.48 °C |
| Boiling Point | 336.05 °C, 325.5±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 150.6±23.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H314-H335 Details |
| Safety Statements | P260-P261-P264-P270-P271-P280-P301+P312-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P312-P330-P363-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |