| Cangzhou Senary Chemical S & T Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.senary.com | |||
![]() | +86 (317) 548-9300 | |||
![]() | +86 (317) 548-9300 | |||
![]() | sale01@senary.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2003 | ||||
| chemBlink Standard supplier since 2008 | ||||
| ZHIYU Biotechnology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.zhiyubiotech.com | |||
![]() | +86 (512) 6279-1916 | |||
![]() | +86 (512) 6279-1915 | |||
![]() | sales@zhiyubiotech.com info@zhiyubiotech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink Standard supplier since 2009 | ||||
| Beijing Eagle Sky Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Hangzhou Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.leapchem.com | |||
![]() | +86 (571) 8771-1850 | |||
![]() | market19@leapchem.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2006 | ||||
| chemBlink Standard supplier since 2015 | ||||
| Amadis Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.amadischem.com | |||
![]() | +86 (571) 8992-5085 | |||
![]() | +86 (571) 8992-5065 | |||
![]() | sales@amadischem.com | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink Standard supplier since 2015 | ||||
| Coresyn Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.coresyn.com | |||
![]() | +86 (571) 8662-6709 | |||
![]() | sales@coresyn.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2016 | ||||
| Cangzhou Enke Pharma-tech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.enkepharma.com | |||
![]() | +86 (317) 529-6180 510-6597 +86 15533709196 | |||
![]() | +86 (317) 510-6596 | |||
![]() | sale@enkepharma.com enkepharma@126.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: ymzhao | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Zhuhai Hairuide Bioscience and Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.zhhairuide.com | |||
![]() | +86 (756) 778-9199 +86 13326687259 +86 13326687289 +86 15913232160 | |||
![]() | +86 (756) 778-9099 | |||
![]() | sales@zhhairuide.com zhengyanhong@zhhairuide.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2019 | ||||
| Jinan Lead Pharm-chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.leadchem.net | |||
![]() | +86 13127158727 | |||
![]() | leadqls@leadchem.net | |||
| Chemical manufacturer since 2013 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Neostar United (Changzhou) Industrial Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.neostarunited.com | |||
![]() | +86 (519) 8555-7386 +86 18015025600 | |||
![]() | +86 (519) 8555-7389 | |||
![]() | marketing1@neostarunited.com | |||
| Chemical distributor since 2014 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound >> Chloropyridine |
|---|---|
| Name | N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester |
| Synonyms | ethyl 2-[(5-chloropyridin-2-yl)amino]-2-oxoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 |
| CAS Registry Number | 349125-08-2 |
| SMILES | CCOC(=O)C(=O)NC1=NC=C(C=C1)Cl |
| Solubility | Slightly soluble (1.1 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.392±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Index of Refraction | 1.579, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H319-H372-H410 Details |
| Safety Statements | P260-P264-P273-P301+P312-P305+P351+P338-P314 Details |
| SDS | Available |
|
N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester is a chemical compound used in medicinal and chemical research, particularly for its potential applications in drug discovery and development. This compound is a derivative of oxalamic acid, where the oxalamic acid functional group is attached to a 5-chloropyridin-2-yl moiety. The unique structure of N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester lends it to various research applications, particularly in the areas of enzyme inhibition and the synthesis of novel pharmaceuticals. The compound was first identified as a potential candidate for the development of small molecules capable of interacting with certain biological targets, including enzymes and receptors involved in diseases such as cancer and neurodegenerative disorders. Its design was based on the need for new molecules with specific binding characteristics that could be fine-tuned for therapeutic applications. The 5-chloropyridine group provides the molecule with the ability to interact with certain protein targets, while the oxalamic acid ester group can be used for further chemical modifications or as a part of a larger molecular scaffold in drug design. The synthesis of N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester typically involves a series of reactions that build the oxalamic acid structure while incorporating the 5-chloropyridine moiety. This compound has been the subject of significant interest in medicinal chemistry due to its ability to serve as an intermediate or building block in the synthesis of more complex compounds. It has shown promise in modulating specific biological pathways, making it a valuable tool in the development of targeted therapies. The compound's molecular structure allows it to engage in specific interactions with target proteins, which is crucial for its role in drug discovery and development. One of the primary applications of N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester is in the field of enzyme inhibition. It has been studied for its potential to inhibit enzymes involved in key biological processes, such as protein synthesis, cell division, or metabolic pathways that are implicated in disease progression. Enzyme inhibitors are essential tools in drug discovery because they can modulate disease-related pathways and potentially lead to the development of therapeutic agents. This compound’s potential for enzyme inhibition has opened the door for its use in researching treatments for diseases such as cancer, autoimmune disorders, and neurological conditions. In addition to its role in enzyme inhibition, N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester has been explored for its ability to act as a precursor in the synthesis of more complex biologically active compounds. Its versatility in chemical modification makes it a valuable building block for creating molecules with different pharmacological properties. Researchers continue to investigate how this compound can be optimized and modified for greater efficacy in therapeutic applications. As the field of drug discovery advances, N-(5-Chloropyridin-2-yl)oxalamic acid ethyl ester is likely to remain an important molecule for researchers seeking to develop new treatments for a range of diseases. Its combination of functional groups and its potential to interact with various biological targets make it an exciting compound for future studies. References 2014. Edoxaban. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-05-0127 |
| Market Analysis Reports |