| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Name | D-Arabinofuranose |
|---|---|
| Synonyms | (3S,4S,5R)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol; arabinofuranose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 41546-26-3 |
| SMILES | O[C@@H]1[C@H](OC(O)[C@H]1O)CO |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-ZRMNMSDTSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.36°C at 760 mmHg (Cal.) |
| Flash point | 180.812°C (Cal.) |
| (1) | Lucía Gandolfi-Donadío, Malena Santos, Rosa M. de Lederkremer and Carola Gallo-Rodriguez. Synthesis of arabinofuranose branched galactofuran tetrasaccharides, constituents of mycobacterial arabinogalactan, Org. Biomol. Chem., 2011, 9, 2085. |
|---|---|
| Market Analysis Reports |