| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| AK Scientific, Inc | USA | |||
|---|---|---|---|---|
![]() |
+1 (510) 429-8835 | |||
![]() |
sales@aksci.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Celtic Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1656) 749-358 | |||
![]() |
sales@celticchemicals.co.uk | |||
| Chemical manufacturer | ||||
| Name | Cupric Benzoate |
|---|---|
| Synonyms | Cupric Dibenzoate; Nsc 112215 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10CuO4 |
| Molecular Weight | 305.78 |
| CAS Registry Number | 533-01-7 |
| EINECS | 208-552-6 |
| SMILES | [Cu++].C1=C(C(=O)[O-])C=CC=C1.C2=C(C(=O)[O-])C=CC=C2 |
| InChI | 1S/2C7H6O2.Cu/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 |
| InChIKey | YEOCHZFPBYUXMC-UHFFFAOYSA-L |
| Boiling point | 249.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.4°C (Cal.) |
| (1) | Satoshi Takamizawa, Ei-ichi Nakata, Teruo Saito, Takamasa Akatsuka and Kenichi Kojima. Construction of oxygen inclusion solid using copper(ii) benzoate–pyrazine, CrystEngComm, 2004, 6, 197. |
|---|---|
| Market Analysis Reports |