|
CAS#: 607-52-3 Product: Bis(1-Naphtyl) Ether No suppilers available for the product. |
| Name | Bis(1-Naphtyl) Ether |
|---|---|
| Synonyms | 1-(1-Naphthyloxy)Naphthalene; 1-Naphthyl Ether; Nsc37201 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 |
| CAS Registry Number | 607-52-3 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)OC4=C3C=CC=CC3=CC=C4 |
| InChI | 1S/C20H14O/c1-3-11-17-15(7-1)9-5-13-19(17)21-20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
| InChIKey | ARNKHYQYAZLEEP-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.95°C at 760 mmHg (Cal.) |
| Flash point | 226.077°C (Cal.) |
| (1) | Travis L. Benanti, Pranorm Saejueng and D. Venkataraman. Segregated assemblies in bridged electron-rich and electron-poor p-conjugated moieties, Chem. Commun., 2007, 0, 692. |
|---|---|
| Market Analysis Reports |