| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 6-Phenyl-2,2'-Bipyridine |
|---|---|
| Synonyms | 6-phenyl-2,2′-bipyridyl; 6-phenyl-2,2’-bipyridine; 6-phenyl-2,2'-bipyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 61633-06-5 |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)C3=CC=CC=N3 |
| InChI | 1S/C16H12N2/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15/h1-12H |
| InChIKey | POIHGNUQPJHDTP-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.3±27.0°C at 760 mmHg (Cal.) |
| Flash point | 148.2±15.4°C (Cal.) |
| (1) | Edwin C. Constable, Catherine E. Housecroft, Jason R. Price and Jennifer A. Zampese. When five are six: the myth of five-coordinate copper(ii), CrystEngComm, 2010, 12, 3163. |
|---|---|
| Market Analysis Reports |