| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Hainanolide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 |
| CAS Registry Number | 64761-48-4 |
| SMILES | [C@@H]25[C@@H]1[C@@H]4OC3C1OC(=O)C2([C@H]3C)CCC6=CC(=O)C=C(C4=C56)C |
| InChI | 1S/C19H18O4/c1-7-5-10(20)6-9-3-4-19-8(2)15-17(23-18(19)21)13-14(19)12(9)11(7)16(13)22-15/h5-6,8,13-17H,3-4H2,1-2H3/t8-,13+,14+,15?,16+,17?,19?/m0/s1 |
| InChIKey | QNJIIOHVULPMRL-OFSDVKARSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.451°C at 760 mmHg (Cal.) |
| Flash point | 270.541°C (Cal.) |
| (1) | O'Sullivan Timothy P.. Model studies toward the synthesis of the bioactive diterpenoid, harringtonolide, Organic & Biomolecular Chemistry, 2007 |
|---|---|
| Market Analysis Reports |