|
CAS#: 731-40-8 Product: Thalidomide No suppilers available for the product. |
| Name | Thalidomide |
|---|---|
| Synonyms | 2-(2,6-Dioxo-3-Piperidyl)Isoindoline-1,3-Dione; 2-(2,6-Dioxo-3-Piperidinyl)Isoindoline-1,3-Dione; 2-(2,6-Diketo-3-Piperidyl)Isoindoline-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 731-40-8 |
| SMILES | C1=CC=CC3=C1C(N(C2C(NC(=O)CC2)=O)C3=O)=O |
| InChI | 1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17) |
| InChIKey | UEJJHQNACJXSKW-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 269-271°C (Expl.) |
| Boiling point | 509.7±43.0°C at 760 mmHg (Cal.) |
| Flash point | 262.1±28.2°C (Cal.) |
| solubility | Soluble to 25 mM in DMSO |
| Safety Description | Safety glasses, adequate ventilation, gloves. Do not handle if pregnant. |
|---|---|
| Market Analysis Reports |