| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,8,8-Trimethyl-3-Oxabicyclo[3.2.1]Octane-2,4-Dione |
|---|---|
| Synonyms | 1,8,8-Trimethyl-3-Oxabicyclo[3.2.1]Octane-2,4-Quinone; Nci60_020164; 3-Oxabicyclo[3.2.1]Octane-2,4-Dione, 1,8,8-Trimethyl-, (1S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 76-32-4 |
| EINECS | 200-952-9 |
| SMILES | CC12C(C(C(=O)OC1=O)CC2)(C)C |
| InChI | 1S/C10H14O3/c1-9(2)6-4-5-10(9,3)8(12)13-7(6)11/h6H,4-5H2,1-3H3 |
| InChIKey | VFZDNKRDYPTSTP-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.999°C at 760 mmHg (Cal.) |
| Flash point | 121.081°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Husár Branislav, Lukáč Ivan. Photooxidation of camphorquinone in polystyrene matrix, Journal of Photochemistry and Photobiology A: Chemistry, 2011 |
|---|---|
| Market Analysis Reports |