| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Metal halides and halides >> Metal bromide and salt |
|---|---|
| Name | Caramiphen |
| Synonyms | 1-Phenyl-1-Cyclopentanecarboxylic Acid 2-Diethylaminoethyl Ester; 1-Phenylcyclopentane-1-Carboxylic Acid 2-Diethylaminoethyl Ester; Caramiphenum [Inn-Latin] |
| Molecular Structure | ![]() |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 |
| CAS Registry Number | 77-22-5 |
| EINECS | 201-013-6 |
| SMILES | C2=C(C1(C(OCCN(CC)CC)=O)CCCC1)C=CC=C2 |
| InChI | 1S/C18H27NO2/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey | OFAIGZWCDGNZGT-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 124.8±14.0°C (Cal.) |
| Market Analysis Reports |