| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Tin(2+) (9Z,12Z,15Z,)-9,12,15-Octadecatrienoate |
|---|---|
| Synonyms | (9E,12E,15E)-Octadeca-9,12,15-Trienoic Acid; Bio1_000727; Linolenic_Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.43 |
| CAS Registry Number | 85392-75-2 (1955-33-5;28290-79-1) |
| EINECS | 286-933-6 |
| SMILES | C(C\C=C\C\C=C\C\C=C\CC)CCCCCC(O)=O |
| InChI | 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3+,7-6+,10-9+ |
| InChIKey | DTOSIQBPPRVQHS-IUQGRGSQSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.376°C at 760 mmHg (Cal.) |
| Flash point | 275.733°C (Cal.) |
| (1) | Yun-Qing Huang, Jia-Qi Liu, Hanyu Gong, Jing Yang, Yangsheng Li and Yu-Qi Feng. Use of isotope mass probes for metabolic analysis of the jasmonate biosynthetic pathway, Analyst, 2011, 136, 1515. |
|---|---|
| Market Analysis Reports |