|
CAS#: 9007-81-2 Product: 4-Amino-1-(beta-D-arabinofuranosyl)-5-fluoro-2(1H)-pyrimidinone No suppilers available for the product. |
| Classification | Biochemical >> Biochemical reagent >> Adjuvant |
|---|---|
| Name | 4-Amino-1-(beta-D-arabinofuranosyl)-5-fluoro-2(1H)-pyrimidinone |
| Synonyms | 10/6/4298; 1-β-D-Arabinofuranosyl-5-fluorocytosine; 2(1H)-Pyr |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12FN3O5 |
| Molecular Weight | 261.21 |
| CAS Registry Number | 9007-81-2 |
| SMILES | FC=1\C(=N/C(=O)N(C=1)[C@@H]2O[C@@H]([C@@H](O)[C@@H]2O)CO)\N |
| InChI | 1S/C9H12FN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6+,8-/m1/s1 |
| InChIKey | STRZQWQNZQMHQR-MNCSTQPFSA-N |
| Density | 1.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.438°C at 760 mmHg (Cal.) |
| Flash point | 263.109°C (Cal.) |
| (1) | Shuna Liu, Qian Wang, Dongxiao Chen, Juan Jin, Yaojuan Hu, Ping Wu, Hui Zhang and Chenxin Cai. Electrochemical approach for the specific detection of hepatitis C virus based on site-specific DNA cleavage of BamHI endonuclease, Anal. Methods, 2010, 2, 135. |
|---|---|
| Market Analysis Reports |