| Abcam | USA | |||
|---|---|---|---|---|
![]() |
us.orders@abcam.com | |||
| Chemical manufacturer since 1998 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 4-(3-Phosphonopropyl)-2-piperazinecarboxylic acid |
|---|---|
| Synonyms | (+)-3-(2-Carboxypiperazin-4-yl)-propyl-1-phosphoric Acid; (±)-3-(2-Carboxypiperazin-4-yl)propyl-1-phosphonic acid; (±)-3-(2-Carboxypiperazin-4-yl)propyl-1-phosphonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17N2O5P |
| Molecular Weight | 252.20 |
| CAS Registry Number | 9075-64-3 |
| SMILES | C1CN(CC(N1)C(=O)O)CCCP(=O)(O)O |
| InChI | 1S/C8H17N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-16(13,14)15/h7,9H,1-6H2,(H,11,12)(H2,13,14,15) |
| InChIKey | CUVGUPIVTLGRGI-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.7±60.0°C at 760 mmHg (Cal.) |
| Flash point | 284.4±32.9°C (Cal.) |
| solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| Market Analysis Reports |