| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Ethyl-2-Hydroxymethyl-1,3-Propanediol Trimethacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2,2-Bis[(2-Methyl-1-Oxoprop-2-Enoxy)Methyl]Butyl Ester; 2-Methylacrylic Acid 2,2-Bis(Methacryloyloxymethyl)Butyl Ester; Ncgc00164106-01 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 |
| CAS Registry Number | 96082-02-9 (102068-89-3) |
| SMILES | C(C(COC(C(C)=C)=O)(COC(C(C)=C)=O)CC)OC(C(C)=C)=O |
| InChI | 1S/C18H26O6/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7/h2,4,6,8-11H2,1,3,5,7H3 |
| InChIKey | OKKRPWIIYQTPQF-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Melting point | -14°C (Expl.) |
| Boiling point | 422.051°C at 760 mmHg (Cal.) |
| Flash point | 181.418°C (Cal.) |
| (1) | Qian Tang, Xianzhu Meng, Hongbo Jiang, Tianyou Zhou, Chengbin Gong, Xiangkai Fu and Sanqiang Shi. Synthesis and characterization of photo- and pH-responsive nanoparticles containing amino-substituted azobenzene, J. Mater. Chem., 2010, 20, 9133. |
|---|---|
| Market Analysis Reports |